C15H13N3O3 — CID 127049188
6-(2-phenylethoxy)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 127049188) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 6-(2-phenylethoxy)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 6-(2-phenylethoxy)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 127049188 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 6-(2-phenylethoxy)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2ccc(OCCc3ccccc3)nc2[nH]c1=O |
| InChI | InChI=1S/C15H13N3O3/c19-14-15(20)18-13-11(16-14)6-7-12(17-13)21-9-8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,16,19)(H,17,18,20) |
| InChIKey | KKOQNEKPTCRKKF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|