C12H10ClN3O4 — CID 114676370
5-chloro-4-(2,4-dimethyl-6-nitrophenoxy)-1H-pyrimidin-6-one (PubChem CID 114676370) has the molecular formula C12H10ClN3O4 and a molecular weight of 295.68 g/mol. Its IUPAC name is 5-chloro-4-(2,4-dimethyl-6-nitrophenoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2,4-dimethyl-6-nitrophenoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114676370 |
| Molecular Formula | C12H10ClN3O4 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 5-chloro-4-(2,4-dimethyl-6-nitrophenoxy)-1H-pyrimidin-6-one |
| SMILES | Cc1cc(C)c(Oc2nc[nH]c(=O)c2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10ClN3O4/c1-6-3-7(2)10(8(4-6)16(18)19)20-12-9(13)11(17)14-5-15-12/h3-5H,1-2H3,(H,14,15,17) |
| InChIKey | MTKGWHNTHOKOHZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|