C16H19BrFNO2 — CID 114676848
N-[[5-[(5-bromo-2-fluorophenoxy)methyl]-2-methylfuran-3-yl]methyl]propan-2-amine (PubChem CID 114676848) has the molecular formula C16H19BrFNO2 and a molecular weight of 356.24 g/mol. Its IUPAC name is N-[[5-[(5-bromo-2-fluorophenoxy)methyl]-2-methylfuran-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-[(5-bromo-2-fluorophenoxy)methyl]-2-methylfuran-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 114676848 |
| Molecular Formula | C16H19BrFNO2 |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-[[5-[(5-bromo-2-fluorophenoxy)methyl]-2-methylfuran-3-yl]methyl]propan-2-amine |
| SMILES | Cc1oc(COc2cc(Br)ccc2F)cc1CNC(C)C |
| InChI | InChI=1S/C16H19BrFNO2/c1-10(2)19-8-12-6-14(21-11(12)3)9-20-16-7-13(17)4-5-15(16)18/h4-7,10,19H,8-9H2,1-3H3 |
| InChIKey | NKXUVICJFCLUAM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |