C13H20F3NO2 — CID 82957504
N-[[2-methyl-5-(3,3,3-trifluoropropoxymethyl)furan-3-yl]methyl]propan-2-amine (PubChem CID 82957504) has the molecular formula C13H20F3NO2 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[[2-methyl-5-(3,3,3-trifluoropropoxymethyl)furan-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[2-methyl-5-(3,3,3-trifluoropropoxymethyl)furan-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 82957504 |
| Molecular Formula | C13H20F3NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-[[2-methyl-5-(3,3,3-trifluoropropoxymethyl)furan-3-yl]methyl]propan-2-amine |
| SMILES | Cc1oc(COCCC(F)(F)F)cc1CNC(C)C |
| InChI | InChI=1S/C13H20F3NO2/c1-9(2)17-7-11-6-12(19-10(11)3)8-18-5-4-13(14,15)16/h6,9,17H,4-5,7-8H2,1-3H3 |
| InChIKey | VEJDVYBUDPPFKY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|