C11H11BrFN5O2 — CID 114677402
[4-(5-bromo-2-fluorophenoxy)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 114677402) has the molecular formula C11H11BrFN5O2 and a molecular weight of 344.14 g/mol. Its IUPAC name is [4-(5-bromo-2-fluorophenoxy)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(5-bromo-2-fluorophenoxy)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 114677402 |
| Molecular Formula | C11H11BrFN5O2 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | [4-(5-bromo-2-fluorophenoxy)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCOc1nc(NN)nc(Oc2cc(Br)ccc2F)n1 |
| InChI | InChI=1S/C11H11BrFN5O2/c1-2-19-10-15-9(18-14)16-11(17-10)20-8-5-6(12)3-4-7(8)13/h3-5H,2,14H2,1H3,(H,15,16,17,18) |
| InChIKey | RYKDDXNRFRNBCN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|