C12H14BrN5O2 — CID 80925530
[4-(4-bromo-2-methylphenoxy)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80925530) has the molecular formula C12H14BrN5O2 and a molecular weight of 340.18 g/mol. Its IUPAC name is [4-(4-bromo-2-methylphenoxy)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(4-bromo-2-methylphenoxy)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80925530 |
| Molecular Formula | C12H14BrN5O2 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | [4-(4-bromo-2-methylphenoxy)-6-ethoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCOc1nc(NN)nc(Oc2ccc(Br)cc2C)n1 |
| InChI | InChI=1S/C12H14BrN5O2/c1-3-19-11-15-10(18-14)16-12(17-11)20-9-5-4-8(13)6-7(9)2/h4-6H,3,14H2,1-2H3,(H,15,16,17,18) |
| InChIKey | SVTHZMUKSDBDKA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|