C10H19F3N2O — CID 114677836
1-(3-amino-1,1,1-trifluorobutan-2-yl)-3-methylpiperidin-4-ol (PubChem CID 114677836) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-(3-amino-1,1,1-trifluorobutan-2-yl)-3-methylpiperidin-4-ol.
| Compound Name | 1-(3-amino-1,1,1-trifluorobutan-2-yl)-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 114677836 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-(3-amino-1,1,1-trifluorobutan-2-yl)-3-methylpiperidin-4-ol |
| SMILES | CC(N)C(N1CCC(O)C(C)C1)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O/c1-6-5-15(4-3-8(6)16)9(7(2)14)10(11,12)13/h6-9,16H,3-5,14H2,1-2H3 |
| InChIKey | WRVFFNDMHNSECZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |