C31H53NO10S — CID 11467797
5-decyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)-N-methylsulfonylbenzamide (PubChem CID 11467797) has the molecular formula C31H53NO10S and a molecular weight of 631.83 g/mol. Its IUPAC name is 5-decyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)-N-methylsulfonylbenzamide.
| Compound Name | 5-decyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 11467797 |
| Molecular Formula | C31H53NO10S |
| Molecular Weight | 631.83 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | 5-decyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)-N-methylsulfonylbenzamide |
| SMILES | CCCCCCCCCCc1ccc(OCC2COCCOCCOCCOCCOCCO2)c(C(=O)NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C31H53NO10S/c1-3-4-5-6-7-8-9-10-11-27-12-13-30(29(24-27)31(33)32-43(2,34)35)42-26-28-25-40-21-20-38-17-16-36-14-15-37-18-19-39-22-23-41-28/h12-13,24,28H,3-11,14-23,25-26H2,1-2H3,(H,32,33) |
| InChIKey | MJOSGQINDCLJFH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.83 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|