C10H21N3O2 — CID 114678035
N-(2-aminoethyl)-2-(4-hydroxy-3-methylpiperidin-1-yl)acetamide (PubChem CID 114678035) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(4-hydroxy-3-methylpiperidin-1-yl)acetamide.
| Compound Name | N-(2-aminoethyl)-2-(4-hydroxy-3-methylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 114678035 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | N-(2-aminoethyl)-2-(4-hydroxy-3-methylpiperidin-1-yl)acetamide |
| SMILES | CC1CN(CC(=O)NCCN)CCC1O |
| InChI | InChI=1S/C10H21N3O2/c1-8-6-13(5-2-9(8)14)7-10(15)12-4-3-11/h8-9,14H,2-7,11H2,1H3,(H,12,15) |
| InChIKey | USBUIYUUEIRGLE-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |