C16H24F2N2O — CID 114679353
1-[2,6-difluoro-4-(propylaminomethyl)phenyl]-3-methylpiperidin-4-ol (PubChem CID 114679353) has the molecular formula C16H24F2N2O and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-(propylaminomethyl)phenyl]-3-methylpiperidin-4-ol.
| Compound Name | 1-[2,6-difluoro-4-(propylaminomethyl)phenyl]-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 114679353 |
| Molecular Formula | C16H24F2N2O |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-[2,6-difluoro-4-(propylaminomethyl)phenyl]-3-methylpiperidin-4-ol |
| SMILES | CCCNCc1cc(F)c(N2CCC(O)C(C)C2)c(F)c1 |
| InChI | InChI=1S/C16H24F2N2O/c1-3-5-19-9-12-7-13(17)16(14(18)8-12)20-6-4-15(21)11(2)10-20/h7-8,11,15,19,21H,3-6,9-10H2,1-2H3 |
| InChIKey | XSATYZPWCUXSAM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|