C16H25F2N3 — CID 114538745
N-[[3,5-difluoro-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]methyl]ethanamine (PubChem CID 114538745) has the molecular formula C16H25F2N3 and a molecular weight of 297.39 g/mol. Its IUPAC name is N-[[3,5-difluoro-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]methyl]ethanamine.
| Compound Name | N-[[3,5-difluoro-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 114538745 |
| Molecular Formula | C16H25F2N3 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | N-[[3,5-difluoro-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(F)c(N2CC(C)N(C)C(C)C2)c(F)c1 |
| InChI | InChI=1S/C16H25F2N3/c1-5-19-8-13-6-14(17)16(15(18)7-13)21-9-11(2)20(4)12(3)10-21/h6-7,11-12,19H,5,8-10H2,1-4H3 |
| InChIKey | VZEKJIKJQIGJIW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|