C17H26F2N2 — CID 114594244
N-[[3,5-difluoro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]ethanamine (PubChem CID 114594244) has the molecular formula C17H26F2N2 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[[3,5-difluoro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]ethanamine.
| Compound Name | N-[[3,5-difluoro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 114594244 |
| Molecular Formula | C17H26F2N2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-[[3,5-difluoro-4-(2,3,5-trimethylpiperidin-1-yl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(F)c(N2CC(C)CC(C)C2C)c(F)c1 |
| InChI | InChI=1S/C17H26F2N2/c1-5-20-9-14-7-15(18)17(16(19)8-14)21-10-11(2)6-12(3)13(21)4/h7-8,11-13,20H,5-6,9-10H2,1-4H3 |
| InChIKey | JFQMFHWICJWNBN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|