C15H18F2N4 — CID 63077696
N-[[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3,5-difluorophenyl]methyl]ethanamine (PubChem CID 63077696) has the molecular formula C15H18F2N4 and a molecular weight of 292.33 g/mol. Its IUPAC name is N-[[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3,5-difluorophenyl]methyl]ethanamine.
| Compound Name | N-[[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3,5-difluorophenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 63077696 |
| Molecular Formula | C15H18F2N4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-[[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3,5-difluorophenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(F)c(N2CCn3ccnc3C2)c(F)c1 |
| InChI | InChI=1S/C15H18F2N4/c1-2-18-9-11-7-12(16)15(13(17)8-11)21-6-5-20-4-3-19-14(20)10-21/h3-4,7-8,18H,2,5-6,9-10H2,1H3 |
| InChIKey | SFAXUVRVZUCAMS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|