C13H13BrFN3 — CID 114067824
7-[2-(bromomethyl)-6-fluorophenyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 114067824) has the molecular formula C13H13BrFN3 and a molecular weight of 310.17 g/mol. Its IUPAC name is 7-[2-(bromomethyl)-6-fluorophenyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
| Compound Name | 7-[2-(bromomethyl)-6-fluorophenyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 114067824 |
| Molecular Formula | C13H13BrFN3 |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 7-[2-(bromomethyl)-6-fluorophenyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| SMILES | Fc1cccc(CBr)c1N1CCn2ccnc2C1 |
| InChI | InChI=1S/C13H13BrFN3/c14-8-10-2-1-3-11(15)13(10)18-7-6-17-5-4-16-12(17)9-18/h1-5H,6-9H2 |
| InChIKey | UARGAHAGFCLMMC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|