C35H42N6O5S — CID 11467966
4-[[[2-[3-[(2R)-2-[[(2R)-2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]acetyl]amino]methyl]-N-[[3-(ethylsulfamoyl)phenyl]methyl]benzamide (PubChem CID 11467966) has the molecular formula C35H42N6O5S and a molecular weight of 658.83 g/mol. Its IUPAC name is 4-[[[2-[3-[(2R)-2-[[(2R)-2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]acetyl]amino]methyl]-N-[[3-(ethylsulfamoyl)phenyl]methyl]benzamide.
| Compound Name | 4-[[[2-[3-[(2R)-2-[[(2R)-2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]acetyl]amino]methyl]-N-[[3-(ethylsulfamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 11467966 |
| Molecular Formula | C35H42N6O5S |
| Molecular Weight | 658.83 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | 4-[[[2-[3-[(2R)-2-[[(2R)-2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]acetyl]amino]methyl]-N-[[3-(ethylsulfamoyl)phenyl]methyl]benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(CNC(=O)c2ccc(CNC(=O)Cc3cccc(C[C@@H](C)NC[C@H](O)c4ccc(N)nc4)c3)cc2)c1 |
| InChI | InChI=1S/C35H42N6O5S/c1-3-41-47(45,46)31-9-5-8-28(18-31)21-40-35(44)29-12-10-25(11-13-29)20-39-34(43)19-27-7-4-6-26(17-27)16-24(2)37-23-32(42)30-14-15-33(36)38-22-30/h4-15,17-18,22,24,32,37,41-42H,3,16,19-21,23H2,1-2H3,(H2,36,38)(H,39,43)(H,40,44)/t24-,32+/m1/s1 |
| InChIKey | LVQYKWVLVGOCMD-QNLPTKCRSA-N |
| XLogP | 3.01 |
| TPSA | 175.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.83 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |