C33H38N6O5S — CID 11763562
4-[[[2-[3-[2-[[(2R)-2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]acetyl]amino]methyl]-N-[(4-sulfamoylphenyl)methyl]benzamide (PubChem CID 11763562) has the molecular formula C33H38N6O5S and a molecular weight of 630.77 g/mol. Its IUPAC name is 4-[[[2-[3-[2-[[(2R)-2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]acetyl]amino]methyl]-N-[(4-sulfamoylphenyl)methyl]benzamide.
| Compound Name | 4-[[[2-[3-[2-[[(2R)-2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]acetyl]amino]methyl]-N-[(4-sulfamoylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 11763562 |
| Molecular Formula | C33H38N6O5S |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | 4-[[[2-[3-[2-[[(2R)-2-(6-amino-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]acetyl]amino]methyl]-N-[(4-sulfamoylphenyl)methyl]benzamide |
| SMILES | CC(Cc1cccc(CC(=O)NCc2ccc(C(=O)NCc3ccc(S(N)(=O)=O)cc3)cc2)c1)NC[C@H](O)c1ccc(N)nc1 |
| InChI | InChI=1S/C33H38N6O5S/c1-22(36-21-30(40)28-11-14-31(34)37-20-28)15-25-3-2-4-26(16-25)17-32(41)38-18-23-5-9-27(10-6-23)33(42)39-19-24-7-12-29(13-8-24)45(35,43)44/h2-14,16,20,22,30,36,40H,15,17-19,21H2,1H3,(H2,34,37)(H,38,41)(H,39,42)(H2,35,43,44)/t22?,30-/m0/s1 |
| InChIKey | ZUYDFNIUGUJEQA-YBJSGSKQSA-N |
| XLogP | 2.35 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |