C12H19Cl2N3 — CID 114682232
4-chloro-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3-methylpiperidine (PubChem CID 114682232) has the molecular formula C12H19Cl2N3 and a molecular weight of 276.21 g/mol. Its IUPAC name is 4-chloro-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3-methylpiperidine.
| Compound Name | 4-chloro-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 114682232 |
| Molecular Formula | C12H19Cl2N3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-chloro-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3-methylpiperidine |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCC(Cl)C(C)C1 |
| InChI | InChI=1S/C12H19Cl2N3/c1-8-6-17(5-4-11(8)13)7-10-9(2)15-16(3)12(10)14/h8,11H,4-7H2,1-3H3 |
| InChIKey | DUOZUKLGXBWBFV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|