C10H17ClN4 — CID 43162347
1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazine (PubChem CID 43162347) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazine.
| Compound Name | 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 43162347 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazine |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCNCC1 |
| InChI | InChI=1S/C10H17ClN4/c1-8-9(10(11)14(2)13-8)7-15-5-3-12-4-6-15/h12H,3-7H2,1-2H3 |
| InChIKey | KWETZHGPBHJYFL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |