About 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane
2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane (PubChem CID 172514454) has the molecular formula C11H17ClN4
and a molecular weight of 240.74 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane |
| PubChem CID | 172514454 |
| Molecular Formula | C11H17ClN4 |
| Molecular Weight | 240.74 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane |
| SMILES | Cc1nn(C)c(Cl)c1CN1CC2(CNC2)C1 |
| InChI | InChI=1S/C11H17ClN4/c1-8-9(10(12)15(2)14-8)3-16-6-11(7-16)4-13-5-11/h13H,3-7H2,1-2H3 |
| InChIKey | DIQRLWQZQVBRDZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.74 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane?
The IUPAC name of 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane (CID 172514454) is 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane.
What is the SMILES notation for 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane?
The canonical SMILES for 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane is Cc1nn(C)c(Cl)c1CN1CC2(CNC2)C1.
What is the InChIKey of 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane?
The InChIKey is DIQRLWQZQVBRDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN4/c1-8-9(10(12)15(2)14-8)3-16-6-11(7-16)4-13-5-11/h13H,3-7H2,1-2H3.
What are the key properties of 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane?
2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane has a molecular weight of 240.74 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,6-diazaspiro[3.3]heptane is sourced from PubChem (CID 172514454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).