C13H16ClN5S — CID 24909547
6-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24909547) has the molecular formula C13H16ClN5S and a molecular weight of 309.83 g/mol. Its IUPAC name is 6-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24909547 |
| Molecular Formula | C13H16ClN5S |
| Molecular Weight | 309.83 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 6-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCc2[nH]c(=S)ncc2C1 |
| InChI | InChI=1S/C13H16ClN5S/c1-8-10(12(14)18(2)17-8)7-19-4-3-11-9(6-19)5-15-13(20)16-11/h5H,3-4,6-7H2,1-2H3,(H,15,16,20) |
| InChIKey | CKTFAPDDOSEWJP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|