C16H16ClN5S — CID 24914650
6-[(6-chloro-2-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24914650) has the molecular formula C16H16ClN5S and a molecular weight of 345.86 g/mol. Its IUPAC name is 6-[(6-chloro-2-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(6-chloro-2-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24914650 |
| Molecular Formula | C16H16ClN5S |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 6-[(6-chloro-2-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | Cc1nc2ccc(Cl)cn2c1CN1CCc2[nH]c(=S)ncc2C1 |
| InChI | InChI=1S/C16H16ClN5S/c1-10-14(22-8-12(17)2-3-15(22)19-10)9-21-5-4-13-11(7-21)6-18-16(23)20-13/h2-3,6,8H,4-5,7,9H2,1H3,(H,18,20,23) |
| InChIKey | UETNUTHJQJEKSO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|