C13H13FN4S — CID 24917274
6-[(3-fluoro-2-pyridinyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24917274) has the molecular formula C13H13FN4S and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-[(3-fluoro-2-pyridinyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(3-fluoro-2-pyridinyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24917274 |
| Molecular Formula | C13H13FN4S |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 6-[(3-fluoro-2-pyridinyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | Fc1cccnc1CN1CCc2[nH]c(=S)ncc2C1 |
| InChI | InChI=1S/C13H13FN4S/c14-10-2-1-4-15-12(10)8-18-5-3-11-9(7-18)6-16-13(19)17-11/h1-2,4,6H,3,5,7-8H2,(H,16,17,19) |
| InChIKey | GVAZSHGMXLNEDI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|