C13H12Br2N4S — CID 24915742
6-[(3,5-dibromo-4-pyridinyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24915742) has the molecular formula C13H12Br2N4S and a molecular weight of 416.14 g/mol. Its IUPAC name is 6-[(3,5-dibromo-4-pyridinyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(3,5-dibromo-4-pyridinyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24915742 |
| Molecular Formula | C13H12Br2N4S |
| Molecular Weight | 416.14 g/mol |
| Exact Mass | 413.91 |
| IUPAC Name | 6-[(3,5-dibromo-4-pyridinyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | S=c1ncc2c([nH]1)CCN(Cc1c(Br)cncc1Br)C2 |
| InChI | InChI=1S/C13H12Br2N4S/c14-10-4-16-5-11(15)9(10)7-19-2-1-12-8(6-19)3-17-13(20)18-12/h3-5H,1-2,6-7H2,(H,17,18,20) |
| InChIKey | DLDUMFYEAIDMCD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|