C12H14N6S — CID 24913516
6-[(2-aminopyrimidin-5-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24913516) has the molecular formula C12H14N6S and a molecular weight of 274.35 g/mol. Its IUPAC name is 6-[(2-aminopyrimidin-5-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(2-aminopyrimidin-5-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24913516 |
| Molecular Formula | C12H14N6S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 6-[(2-aminopyrimidin-5-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | Nc1ncc(CN2CCc3[nH]c(=S)ncc3C2)cn1 |
| InChI | InChI=1S/C12H14N6S/c13-11-14-3-8(4-15-11)6-18-2-1-10-9(7-18)5-16-12(19)17-10/h3-5H,1-2,6-7H2,(H2,13,14,15)(H,16,17,19) |
| InChIKey | HIJNCUUTTSTRGF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|