C14H13Cl2N3S — CID 24928219
6-[(2,3-dichlorophenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24928219) has the molecular formula C14H13Cl2N3S and a molecular weight of 326.25 g/mol. Its IUPAC name is 6-[(2,3-dichlorophenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(2,3-dichlorophenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24928219 |
| Molecular Formula | C14H13Cl2N3S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 6-[(2,3-dichlorophenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | S=c1ncc2c([nH]1)CCN(Cc1cccc(Cl)c1Cl)C2 |
| InChI | InChI=1S/C14H13Cl2N3S/c15-11-3-1-2-9(13(11)16)7-19-5-4-12-10(8-19)6-17-14(20)18-12/h1-3,6H,4-5,7-8H2,(H,17,18,20) |
| InChIKey | HUOWIOYINLKFNE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|