C18H19N5S — CID 24912802
6-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24912802) has the molecular formula C18H19N5S and a molecular weight of 337.45 g/mol. Its IUPAC name is 6-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24912802 |
| Molecular Formula | C18H19N5S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 6-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | Cc1nn(-c2ccccc2)cc1CN1CCc2[nH]c(=S)ncc2C1 |
| InChI | InChI=1S/C18H19N5S/c1-13-15(12-23(21-13)16-5-3-2-4-6-16)11-22-8-7-17-14(10-22)9-19-18(24)20-17/h2-6,9,12H,7-8,10-11H2,1H3,(H,19,20,24) |
| InChIKey | KROJXBPMIKKHQV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|