C22H19ClN4S — CID 24909337
6-[[2-(4-chlorophenyl)-1H-indol-3-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24909337) has the molecular formula C22H19ClN4S and a molecular weight of 406.94 g/mol. Its IUPAC name is 6-[[2-(4-chlorophenyl)-1H-indol-3-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[[2-(4-chlorophenyl)-1H-indol-3-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24909337 |
| Molecular Formula | C22H19ClN4S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 6-[[2-(4-chlorophenyl)-1H-indol-3-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | S=c1ncc2c([nH]1)CCN(Cc1c(-c3ccc(Cl)cc3)[nH]c3ccccc13)C2 |
| InChI | InChI=1S/C22H19ClN4S/c23-16-7-5-14(6-8-16)21-18(17-3-1-2-4-20(17)25-21)13-27-10-9-19-15(12-27)11-24-22(28)26-19/h1-8,11,25H,9-10,12-13H2,(H,24,26,28) |
| InChIKey | OCEZUEGTJUUILP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|