C16H19ClN2 — CID 114682261
6-[(4-chloro-3-methylpiperidin-1-yl)methyl]quinoline (PubChem CID 114682261) has the molecular formula C16H19ClN2 and a molecular weight of 274.79 g/mol. Its IUPAC name is 6-[(4-chloro-3-methylpiperidin-1-yl)methyl]quinoline.
| Compound Name | 6-[(4-chloro-3-methylpiperidin-1-yl)methyl]quinoline |
|---|---|
| PubChem CID | 114682261 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 6-[(4-chloro-3-methylpiperidin-1-yl)methyl]quinoline |
| SMILES | CC1CN(Cc2ccc3ncccc3c2)CCC1Cl |
| InChI | InChI=1S/C16H19ClN2/c1-12-10-19(8-6-15(12)17)11-13-4-5-16-14(9-13)3-2-7-18-16/h2-5,7,9,12,15H,6,8,10-11H2,1H3 |
| InChIKey | SVSXMEQOZQTNNF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|