C15H20ClN3 — CID 120908917
4-methyl-1-(quinolin-6-ylmethyl)pyrrolidin-3-amine;hydrochloride (PubChem CID 120908917) has the molecular formula C15H20ClN3 and a molecular weight of 277.80 g/mol. Its IUPAC name is 4-methyl-1-(quinolin-6-ylmethyl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | 4-methyl-1-(quinolin-6-ylmethyl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120908917 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 4-methyl-1-(quinolin-6-ylmethyl)pyrrolidin-3-amine;hydrochloride |
| SMILES | CC1CN(Cc2ccc3ncccc3c2)CC1N.Cl |
| InChI | InChI=1S/C15H19N3.ClH/c1-11-8-18(10-14(11)16)9-12-4-5-15-13(7-12)3-2-6-17-15;/h2-7,11,14H,8-10,16H2,1H3;1H |
| InChIKey | ZLXFWMNNEKNOAO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |