C13H20ClN5 — CID 120909731
4-methyl-1-[(1-methylbenzotriazol-5-yl)methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 120909731) has the molecular formula C13H20ClN5 and a molecular weight of 281.79 g/mol. Its IUPAC name is 4-methyl-1-[(1-methylbenzotriazol-5-yl)methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | 4-methyl-1-[(1-methylbenzotriazol-5-yl)methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120909731 |
| Molecular Formula | C13H20ClN5 |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-methyl-1-[(1-methylbenzotriazol-5-yl)methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | CC1CN(Cc2ccc3c(c2)nnn3C)CC1N.Cl |
| InChI | InChI=1S/C13H19N5.ClH/c1-9-6-18(8-11(9)14)7-10-3-4-13-12(5-10)15-16-17(13)2;/h3-5,9,11H,6-8,14H2,1-2H3;1H |
| InChIKey | GEPNXZBBMRXAAV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |