C12H9BrN2OS — CID 114684428
3-[1-(4-bromo-1,3-thiazol-2-yl)-1-hydroxyethyl]benzonitrile (PubChem CID 114684428) has the molecular formula C12H9BrN2OS and a molecular weight of 309.19 g/mol. Its IUPAC name is 3-[1-(4-bromo-1,3-thiazol-2-yl)-1-hydroxyethyl]benzonitrile.
| Compound Name | 3-[1-(4-bromo-1,3-thiazol-2-yl)-1-hydroxyethyl]benzonitrile |
|---|---|
| PubChem CID | 114684428 |
| Molecular Formula | C12H9BrN2OS |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 3-[1-(4-bromo-1,3-thiazol-2-yl)-1-hydroxyethyl]benzonitrile |
| SMILES | CC(O)(c1cccc(C#N)c1)c1nc(Br)cs1 |
| InChI | InChI=1S/C12H9BrN2OS/c1-12(16,11-15-10(13)7-17-11)9-4-2-3-8(5-9)6-14/h2-5,7,16H,1H3 |
| InChIKey | JVMCEPSMVXHIQR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |