C13H12FN5O — CID 114685209
[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-(3-methyltriazol-4-yl)methanol (PubChem CID 114685209) has the molecular formula C13H12FN5O and a molecular weight of 273.27 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1H-pyrazol-4-yl]-(3-methyltriazol-4-yl)methanol.
| Compound Name | [5-(4-fluorophenyl)-1H-pyrazol-4-yl]-(3-methyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 114685209 |
| Molecular Formula | C13H12FN5O |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [5-(4-fluorophenyl)-1H-pyrazol-4-yl]-(3-methyltriazol-4-yl)methanol |
| SMILES | Cn1nncc1C(O)c1cn[nH]c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FN5O/c1-19-11(7-16-18-19)13(20)10-6-15-17-12(10)8-2-4-9(14)5-3-8/h2-7,13,20H,1H3,(H,15,17) |
| InChIKey | IKXLOXDOVKVWEG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |