C21H17NO7 — CID 1146861
methyl 2-[(2R)-2-(1,3-benzodioxol-5-yl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]acetate (PubChem CID 1146861) has the molecular formula C21H17NO7 and a molecular weight of 395.37 g/mol. Its IUPAC name is methyl 2-[(2R)-2-(1,3-benzodioxol-5-yl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]acetate.
| Compound Name | methyl 2-[(2R)-2-(1,3-benzodioxol-5-yl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 1146861 |
| Molecular Formula | C21H17NO7 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | methyl 2-[(2R)-2-(1,3-benzodioxol-5-yl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C(=O)C(=C(O)c2ccccc2)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H17NO7/c1-27-16(23)10-22-18(13-7-8-14-15(9-13)29-11-28-14)17(20(25)21(22)26)19(24)12-5-3-2-4-6-12/h2-9,18,24H,10-11H2,1H3/t18-/m1/s1 |
| InChIKey | YDRXKWWZVOKYRQ-GOSISDBHSA-N |
| XLogP | 2.01 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|