C22H19NO7 — CID 1122782
4-[(2R)-2-(1,3-benzodioxol-5-yl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]butanoic acid (PubChem CID 1122782) has the molecular formula C22H19NO7 and a molecular weight of 409.39 g/mol. Its IUPAC name is 4-[(2R)-2-(1,3-benzodioxol-5-yl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]butanoic acid.
| Compound Name | 4-[(2R)-2-(1,3-benzodioxol-5-yl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 1122782 |
| Molecular Formula | C22H19NO7 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 4-[(2R)-2-(1,3-benzodioxol-5-yl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=O)C(=C(O)c2ccccc2)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H19NO7/c24-17(25)7-4-10-23-19(14-8-9-15-16(11-14)30-12-29-15)18(21(27)22(23)28)20(26)13-5-2-1-3-6-13/h1-3,5-6,8-9,11,19,26H,4,7,10,12H2,(H,24,25)/t19-/m1/s1 |
| InChIKey | YDCBHFHLKFJLNW-LJQANCHMSA-N |
| XLogP | 2.70 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|