C16H17N3O — CID 114686222
2-(cyclohexen-1-yl)-1-(3-phenyltriazol-4-yl)ethanone (PubChem CID 114686222) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-(3-phenyltriazol-4-yl)ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-(3-phenyltriazol-4-yl)ethanone |
|---|---|
| PubChem CID | 114686222 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-(3-phenyltriazol-4-yl)ethanone |
| SMILES | O=C(CC1=CCCCC1)c1cnnn1-c1ccccc1 |
| InChI | InChI=1S/C16H17N3O/c20-16(11-13-7-3-1-4-8-13)15-12-17-18-19(15)14-9-5-2-6-10-14/h2,5-7,9-10,12H,1,3-4,8,11H2 |
| InChIKey | NNROXQHYZXKXRL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|