C14H15N3O3S — CID 105131213
2-(1,1-dioxothiolan-3-yl)-1-(3-phenyltriazol-4-yl)ethanone (PubChem CID 105131213) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1-(3-phenyltriazol-4-yl)ethanone.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1-(3-phenyltriazol-4-yl)ethanone |
|---|---|
| PubChem CID | 105131213 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1-(3-phenyltriazol-4-yl)ethanone |
| SMILES | O=C(CC1CCS(=O)(=O)C1)c1cnnn1-c1ccccc1 |
| InChI | InChI=1S/C14H15N3O3S/c18-14(8-11-6-7-21(19,20)10-11)13-9-15-16-17(13)12-4-2-1-3-5-12/h1-5,9,11H,6-8,10H2 |
| InChIKey | GKQGYMVEFWIUDJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |