C13H16FN3OS — CID 114686541
2-(3-fluorophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanol (PubChem CID 114686541) has the molecular formula C13H16FN3OS and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(3-fluorophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanol.
| Compound Name | 2-(3-fluorophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanol |
|---|---|
| PubChem CID | 114686541 |
| Molecular Formula | C13H16FN3OS |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-(3-fluorophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanol |
| SMILES | CCCn1nncc1C(O)CSc1cccc(F)c1 |
| InChI | InChI=1S/C13H16FN3OS/c1-2-6-17-12(8-15-16-17)13(18)9-19-11-5-3-4-10(14)7-11/h3-5,7-8,13,18H,2,6,9H2,1H3 |
| InChIKey | PVIXIWNWFVSUQB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |