C14H22N4S — CID 114687494
N-[1-(3-propyltriazol-4-yl)-2-thiophen-2-ylethyl]propan-1-amine (PubChem CID 114687494) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is N-[1-(3-propyltriazol-4-yl)-2-thiophen-2-ylethyl]propan-1-amine.
| Compound Name | N-[1-(3-propyltriazol-4-yl)-2-thiophen-2-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 114687494 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[1-(3-propyltriazol-4-yl)-2-thiophen-2-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccs1)c1cnnn1CCC |
| InChI | InChI=1S/C14H22N4S/c1-3-7-15-13(10-12-6-5-9-19-12)14-11-16-17-18(14)8-4-2/h5-6,9,11,13,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | HJIPVCLZTVYWGL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |