C15H20ClFN4 — CID 114687612
2-(2-chloro-6-fluorophenyl)-N-ethyl-1-(3-propyltriazol-4-yl)ethanamine (PubChem CID 114687612) has the molecular formula C15H20ClFN4 and a molecular weight of 310.80 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-ethyl-1-(3-propyltriazol-4-yl)ethanamine.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-ethyl-1-(3-propyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 114687612 |
| Molecular Formula | C15H20ClFN4 |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-ethyl-1-(3-propyltriazol-4-yl)ethanamine |
| SMILES | CCCn1nncc1C(Cc1c(F)cccc1Cl)NCC |
| InChI | InChI=1S/C15H20ClFN4/c1-3-8-21-15(10-19-20-21)14(18-4-2)9-11-12(16)6-5-7-13(11)17/h5-7,10,14,18H,3-4,8-9H2,1-2H3 |
| InChIKey | KEJNMWPKTPQHGK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |