C13H16F2N4 — CID 105038776
2-(2,3-difluorophenyl)-1-(3-propyltriazol-4-yl)ethanamine (PubChem CID 105038776) has the molecular formula C13H16F2N4 and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-1-(3-propyltriazol-4-yl)ethanamine.
| Compound Name | 2-(2,3-difluorophenyl)-1-(3-propyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 105038776 |
| Molecular Formula | C13H16F2N4 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(2,3-difluorophenyl)-1-(3-propyltriazol-4-yl)ethanamine |
| SMILES | CCCn1nncc1C(N)Cc1cccc(F)c1F |
| InChI | InChI=1S/C13H16F2N4/c1-2-6-19-12(8-17-18-19)11(16)7-9-4-3-5-10(14)13(9)15/h3-5,8,11H,2,6-7,16H2,1H3 |
| InChIKey | YBVSEKSYCVWNJF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |