C17H22N4 — CID 114688475
2-cyclopropyl-2-(3-phenyltriazol-4-yl)azepane (PubChem CID 114688475) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-cyclopropyl-2-(3-phenyltriazol-4-yl)azepane.
| Compound Name | 2-cyclopropyl-2-(3-phenyltriazol-4-yl)azepane |
|---|---|
| PubChem CID | 114688475 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-cyclopropyl-2-(3-phenyltriazol-4-yl)azepane |
| SMILES | c1ccc(-n2nncc2C2(C3CC3)CCCCCN2)cc1 |
| InChI | InChI=1S/C17H22N4/c1-3-7-15(8-4-1)21-16(13-19-20-21)17(14-9-10-14)11-5-2-6-12-18-17/h1,3-4,7-8,13-14,18H,2,5-6,9-12H2 |
| InChIKey | KBMDDZCMPJTGDW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |