C11H21N5O — CID 114688564
(3-methyltriazol-4-yl)-(4-propan-2-ylmorpholin-2-yl)methanamine (PubChem CID 114688564) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is (3-methyltriazol-4-yl)-(4-propan-2-ylmorpholin-2-yl)methanamine.
| Compound Name | (3-methyltriazol-4-yl)-(4-propan-2-ylmorpholin-2-yl)methanamine |
|---|---|
| PubChem CID | 114688564 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (3-methyltriazol-4-yl)-(4-propan-2-ylmorpholin-2-yl)methanamine |
| SMILES | CC(C)N1CCOC(C(N)c2cnnn2C)C1 |
| InChI | InChI=1S/C11H21N5O/c1-8(2)16-4-5-17-10(7-16)11(12)9-6-13-14-15(9)3/h6,8,10-11H,4-5,7,12H2,1-3H3 |
| InChIKey | JKLZLNZBLKJHLR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |