C14H28N4O — CID 114689268
2-ethoxy-N-ethyl-2-methyl-1-(3-propyltriazol-4-yl)butan-1-amine (PubChem CID 114689268) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-ethoxy-N-ethyl-2-methyl-1-(3-propyltriazol-4-yl)butan-1-amine.
| Compound Name | 2-ethoxy-N-ethyl-2-methyl-1-(3-propyltriazol-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 114689268 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 2-ethoxy-N-ethyl-2-methyl-1-(3-propyltriazol-4-yl)butan-1-amine |
| SMILES | CCCn1nncc1C(NCC)C(C)(CC)OCC |
| InChI | InChI=1S/C14H28N4O/c1-6-10-18-12(11-16-17-18)13(15-8-3)14(5,7-2)19-9-4/h11,13,15H,6-10H2,1-5H3 |
| InChIKey | HZUZNCVHGCNPFC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |