C8H7F3N6 — CID 114690923
4-(3-methyltriazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114690923) has the molecular formula C8H7F3N6 and a molecular weight of 244.18 g/mol. Its IUPAC name is 4-(3-methyltriazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(3-methyltriazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114690923 |
| Molecular Formula | C8H7F3N6 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 4-(3-methyltriazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cn1nncc1-c1cc(C(F)(F)F)nc(N)n1 |
| InChI | InChI=1S/C8H7F3N6/c1-17-5(3-13-16-17)4-2-6(8(9,10)11)15-7(12)14-4/h2-3H,1H3,(H2,12,14,15) |
| InChIKey | LIUZKNSIZIKPFP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |