C8H10F3N3 — CID 82192734
4-propan-2-yl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 82192734) has the molecular formula C8H10F3N3 and a molecular weight of 205.18 g/mol. Its IUPAC name is 4-propan-2-yl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-propan-2-yl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 82192734 |
| Molecular Formula | C8H10F3N3 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 4-propan-2-yl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CC(C)c1cc(C(F)(F)F)nc(N)n1 |
| InChI | InChI=1S/C8H10F3N3/c1-4(2)5-3-6(8(9,10)11)14-7(12)13-5/h3-4H,1-2H3,(H2,12,13,14) |
| InChIKey | UIRICRATEJYHNY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |