C12H18N6 — CID 114690973
N-ethyl-6-(3-methyltriazol-4-yl)-5-propan-2-ylpyrimidin-4-amine (PubChem CID 114690973) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is N-ethyl-6-(3-methyltriazol-4-yl)-5-propan-2-ylpyrimidin-4-amine.
| Compound Name | N-ethyl-6-(3-methyltriazol-4-yl)-5-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114690973 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N-ethyl-6-(3-methyltriazol-4-yl)-5-propan-2-ylpyrimidin-4-amine |
| SMILES | CCNc1ncnc(-c2cnnn2C)c1C(C)C |
| InChI | InChI=1S/C12H18N6/c1-5-13-12-10(8(2)3)11(14-7-15-12)9-6-16-17-18(9)4/h6-8H,5H2,1-4H3,(H,13,14,15) |
| InChIKey | YVTVSICLOORVFD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |