C10H14N6 — CID 114690986
4-(3-methyltriazol-4-yl)-N-propylpyrimidin-2-amine (PubChem CID 114690986) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-(3-methyltriazol-4-yl)-N-propylpyrimidin-2-amine.
| Compound Name | 4-(3-methyltriazol-4-yl)-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 114690986 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4-(3-methyltriazol-4-yl)-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1nccc(-c2cnnn2C)n1 |
| InChI | InChI=1S/C10H14N6/c1-3-5-11-10-12-6-4-8(14-10)9-7-13-15-16(9)2/h4,6-7H,3,5H2,1-2H3,(H,11,12,14) |
| InChIKey | SWBLVWQQHHTWNK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |