C13H19N5O — CID 80877277
N-propyl-4-(1,3,5-trimethylpyrazol-4-yl)oxypyrimidin-2-amine (PubChem CID 80877277) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is N-propyl-4-(1,3,5-trimethylpyrazol-4-yl)oxypyrimidin-2-amine.
| Compound Name | N-propyl-4-(1,3,5-trimethylpyrazol-4-yl)oxypyrimidin-2-amine |
|---|---|
| PubChem CID | 80877277 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-propyl-4-(1,3,5-trimethylpyrazol-4-yl)oxypyrimidin-2-amine |
| SMILES | CCCNc1nccc(Oc2c(C)nn(C)c2C)n1 |
| InChI | InChI=1S/C13H19N5O/c1-5-7-14-13-15-8-6-11(16-13)19-12-9(2)17-18(4)10(12)3/h6,8H,5,7H2,1-4H3,(H,14,15,16) |
| InChIKey | BSIXTCLLYPDSIR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |