C9H11FN6 — CID 114691134
5-fluoro-4-(3-propyltriazol-4-yl)pyrimidin-2-amine (PubChem CID 114691134) has the molecular formula C9H11FN6 and a molecular weight of 222.23 g/mol. Its IUPAC name is 5-fluoro-4-(3-propyltriazol-4-yl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-(3-propyltriazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114691134 |
| Molecular Formula | C9H11FN6 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 5-fluoro-4-(3-propyltriazol-4-yl)pyrimidin-2-amine |
| SMILES | CCCn1nncc1-c1nc(N)ncc1F |
| InChI | InChI=1S/C9H11FN6/c1-2-3-16-7(5-13-15-16)8-6(10)4-12-9(11)14-8/h4-5H,2-3H2,1H3,(H2,11,12,14) |
| InChIKey | ZVVOMJLUDSDSAK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |