C10H20O3 — CID 11469527
(2R)-2,4-diethylhex-5-ene-1,2,4-triol (PubChem CID 11469527) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2R)-2,4-diethylhex-5-ene-1,2,4-triol.
| Compound Name | (2R)-2,4-diethylhex-5-ene-1,2,4-triol |
|---|---|
| PubChem CID | 11469527 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (2R)-2,4-diethylhex-5-ene-1,2,4-triol |
| SMILES | C=CC(O)(CC)C[C@](O)(CC)CO |
| InChI | InChI=1S/C10H20O3/c1-4-9(12,5-2)7-10(13,6-3)8-11/h4,11-13H,1,5-8H2,2-3H3/t9?,10-/m1/s1 |
| InChIKey | DUKLSUBDPPOQIF-QVDQXJPCSA-N |
| XLogP | 0.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|